Organic Acids
eMolecules DBCO-C5-PEG12-acid | Broadpharm |919.075 | C47H70N2O16 | 0.000 | OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC(=O)N1Cc2ccccc2C#Cc2ccccc12 | 1g | 761705995
DBCO-C5-PEG12-acid | Broadpharm |919.075 | C47H70N2O16 | 0.000 | OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC(=O)N1Cc2ccccc2C#Cc2ccccc12 | 1g | 761705995
Medchemexpress LLC Citric acid-13C6 | 287389-42-8 | 198.08 | 1 MG
Citric acid-13C6 is the 13C-labeled Citric acid (HY-N1428). Citric acid is a natural preservative and food tartness enhancer. It has been shown to induce apoptosis and cell cycle arrest at G2/M phase and S phase in HaCaT cells. Additionally, citric acid can cause oxidative damage of the liver by decreasing antioxidative enzyme activities. It is also utilized as an acidulant, emulsifier, sequestrant, and buffering agent across various industries.
- Used as a tracer.
- Can be used as an internal standard for quantitative analysis by NMR, GC-MS, or LC-MS.
- Stable heavy isotopes have been incorporated into drug molecules for quantitation during drug development.
- Deuteration can potentially affect the pharmacokinetic and metabolic profiles of drugs.
eMolecules Medchem Express | Oxaprozin-d4 | 1mg | 415688812 | HY-B0808S | MFCD28900733 | 297.346 | C18H15NO3
Medchem Express | Oxaprozin-d4 | 1mg | 415688812 | HY-B0808S | | MFCD28900733 | 297.346 | C18H15NO3
eMolecules 2137870-36-9 | 4-(1-tert-Butoxycarbonylamino-2,2,2-trifluoro-ethyl)-benzoic acid | J&W PharmLab LLC319.280 | C14H16F3NO4 | 96.000 | CC(C)(C)OC(=O)NC(c1ccc(cc1)C(O)=O)C(F)(F)F | 500mg | 784540597
4-(1-tert-Butoxycarbonylamino-2,2,2-trifluoro-ethyl)-benzoic acid | J&W PharmLab LLC | 2137870-36-9319.280 | C14H16F3NO4 | 96.000 | CC(C)(C)OC(=O)NC(c1ccc(cc1)C(O)=O)C(F)(F)F | 500mg | 784540597
eMolecules 693-23-2 | Ambeed | Dodecanedioic acid | 100g | 552514780 | A101351 | MFCD00002735 | 230.304 | C12H22O4
Ambeed | Dodecanedioic acid | 100g | 552514780 | A101351 | 693-23-2 | MFCD00002735 | 230.304 | C12H22O4
eMolecules 1402666-29-8 | 2-(4-Cyano-phenyl)-5-trifluoromethyl-2H-pyrazole-3-carboxylic acid | J&W PharmLab LLC281.194 | C12H6F3N3O2 | 96.000 | OC(=O)c1cc(nn1-c1ccc(cc1)C#N)C(F)(F)F | 50mg | 746318599
2-(4-Cyano-phenyl)-5-trifluoromethyl-2H-pyrazole-3-carboxylic acid | J&W PharmLab LLC | 1402666-29-8281.194 | C12H6F3N3O2 | 96.000 | OC(=O)c1cc(nn1-c1ccc(cc1)C#N)C(F)(F)F | 50mg | 746318599
Research Products International Corp Citric Acid Anhydrous, 25 KG
Citric acid anhydrous (C₆H₈O₇) is a white, water-soluble compound (192.12 g/mol) used in life science labs as a buffer and chelating agent. It helps maintain pH in enzymatic reactions, electrophoresis, and cell assays, and binds metal ions to stabilize biomolecules in nucleic acid extraction and protein purification protocols.
Medchemexpress LLC 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, 1,2-dimethyl ester | 53798-97-3 | >97.0% | 220.18 | 50 MG
Dimethylurea/citric acid is a highly efficient deep eutectic solvent (DES). It can be utilized as a catalyst and a green reaction medium for the synthesis of bis(indolyl)methanes, quinolines, and aryl-4, 5-diphenyl-1H-imidazoles. This product is a white to off-white solid.
- Highly efficient deep eutectic solvent (DES)
- Can be used as a catalyst
- Functions as a green reaction medium
- Applications in synthesis of bis(indolyl)methanes
- Applications in synthesis of quinolines
- Applications in synthesis of aryl-4, 5-diphenyl-1H-imidazoles
- Store powder at -20°C for 3 years or 4°C for 2 years
- Store in solvent at -80°C for 6 months or -20°C for 1 month
eMolecules 1810001-93-4 | Medchem Express | DBM-MMAF | 5mg | 721310167 | HY-136287 | 1082.97 | C49H74Br2N6O11
Ambeed | (S)-3-Amino-3-(4-bromophenyl)propanoic acid | 5g | 572830187 | A641315 | 275826-36-3 | MFCD03840456 | 244.088 | C9H10BrNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 474923-47-2 | 18:1 Dodecanyl PE | Broadpharm978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473637.JPG-250.jpg)
eMolecules 474923-47-2 | 18:1 Dodecanyl PE | Broadpharm978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531
18:1 Dodecanyl PE | Broadpharm | 474923-47-2978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531
eMolecules 76-04-0 | Ambeed | Chlorodifluoroacetic acid | 5g | 552753748 | A724594 | MFCD00004176 | 130.47 | C2HClF2O2
Ambeed | Chlorodifluoroacetic acid | 5g | 552753748 | A724594 | 76-04-0 | MFCD00004176 | 130.470 | C2HClF2O2
C(O)=O | 5g | 672838586](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502429743.PNG-250.jpg)
eMolecules 192725-50-1 | (S)-3-Methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid | Ambeed | MFCD06797211 | 200.238 | C9H16N2O3 | 97.000 | CC(C)[C@H](N1CCCNC1=O)C(O)=O | 5g | 672838586
(S)-3-Methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid | Ambeed | 192725-50-1 | MFCD06797211 | 200.238 | C9H16N2O3 | 97.000 | CC(C)[C@H](N1CCCNC1=O)C(O)=O | 5g | 672838586
![eMolecules 1175621-48-3 | 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-pentynoic acid | ChemScene213.233 | C10H15NO4 | 97.000 | CC(C)(C)OC(=O)NCCC#CC(O)=O | 100mg | 788449205](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473074.JPG-250.jpg)
eMolecules 1175621-48-3 | 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-pentynoic acid | ChemScene213.233 | C10H15NO4 | 97.000 | CC(C)(C)OC(=O)NCCC#CC(O)=O | 100mg | 788449205
5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-pentynoic acid | ChemScene | 1175621-48-3213.233 | C10H15NO4 | 97.000 | CC(C)(C)OC(=O)NCCC#CC(O)=O | 100mg | 788449205
eMolecules 25503-90-6 | 1-Acetyl-4-piperidinecarboxylic Acid | Ambeed | MFCD00023706 | 171.196 | C8H13NO3 | 95.000 | CC(=O)N1CCC(CC1)C(O)=O | 1g | 549151731
1-Acetyl-4-piperidinecarboxylic Acid | Ambeed | 25503-90-6 | MFCD00023706 | 171.196 | C8H13NO3 | 95.000 | CC(=O)N1CCC(CC1)C(O)=O | 1g | 549151731
eMolecules N-bis(Amine-PEG8)-N-(PEG8-acid), HCl salt | Broadpharm |1232.504 | C55H113N3O26 | 95.000 | NCCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCN)CCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O | 100mg | 784454978
N-bis(Amine-PEG8)-N-(PEG8-acid), HCl salt | Broadpharm |1232.504 | C55H113N3O26 | 95.000 | NCCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCN)CCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O | 100mg | 784454978